C21H41O7P — CID 91252754
[(2R)-2-hydroxy-3-(1-hydroxyoctadeca-9,12-dienoxy)propyl] dihydrogen phosphate (PubChem CID 91252754) has the molecular formula C21H41O7P and a molecular weight of 436.53 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-(1-hydroxyoctadeca-9,12-dienoxy)propyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-hydroxy-3-(1-hydroxyoctadeca-9,12-dienoxy)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91252754 |
| Molecular Formula | C21H41O7P |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(2R)-2-hydroxy-3-(1-hydroxyoctadeca-9,12-dienoxy)propyl] dihydrogen phosphate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C21H41O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26/h6-7,9-10,20-23H,2-5,8,11-19H2,1H3,(H2,24,25,26)/t20-,21?/m1/s1 |
| InChIKey | NFKZPUSDTIVIKP-VQCQRNETSA-N |
| XLogP | 4.61 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|