C36H56O7 — CID 158504537
5,5-dimethyl-4-oxohexanoic acid;4-[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-4-oxobutanoic acid (PubChem CID 158504537) has the molecular formula C36H56O7 and a molecular weight of 600.84 g/mol. Its IUPAC name is 5,5-dimethyl-4-oxohexanoic acid;4-[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-4-oxobutanoic acid.
| Compound Name | 5,5-dimethyl-4-oxohexanoic acid;4-[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158504537 |
| Molecular Formula | C36H56O7 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.40 |
| IUPAC Name | 5,5-dimethyl-4-oxohexanoic acid;4-[(4Z,7Z,10Z,13Z,16Z,19Z)-2-ethyldocosa-4,7,10,13,16,19-hexaenoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)C(=O)CCC(=O)O.CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(CC)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C28H42O4.C8H14O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(4-2)25-32-28(31)24-23-27(29)30;1-8(2,3)6(9)4-5-7(10)11/h5-6,8-9,11-12,14-15,17-18,20-21,26H,3-4,7,10,13,16,19,22-25H2,1-2H3,(H,29,30);4-5H2,1-3H3,(H,10,11)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-; |
| InChIKey | HKHRPIDAXMRKEO-LEQVUPQVSA-N |
| XLogP | 8.97 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|