C25H44O2 — CID 59492262
[(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienyl] 2,2-dimethylpropanoate (PubChem CID 59492262) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is [(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienyl] 2,2-dimethylpropanoate.
| Compound Name | [(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59492262 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | [(9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienyl] 2,2-dimethylpropanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(CC)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H44O2/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(7-2)22-27-24(26)25(3,4)5/h8-9,11-12,14-15,23H,6-7,10,13,16-22H2,1-5H3/b9-8-,12-11-,15-14- |
| InChIKey | BWKCQUAUZRASTR-ORZIMQNZSA-N |
| XLogP | 7.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|