C25H43NO4 — CID 140760649
tert-butyl 3-(nitromethyl)icosa-11,14,17-trienoate (PubChem CID 140760649) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is tert-butyl 3-(nitromethyl)icosa-11,14,17-trienoate.
| Compound Name | tert-butyl 3-(nitromethyl)icosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 140760649 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | tert-butyl 3-(nitromethyl)icosa-11,14,17-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(CC(=O)OC(C)(C)C)C[N+](=O)[O-] |
| InChI | InChI=1S/C25H43NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(22-26(28)29)21-24(27)30-25(2,3)4/h6-7,9-10,12-13,23H,5,8,11,14-22H2,1-4H3 |
| InChIKey | PXRPNUOOIBCFJA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|