C57H68N4O3 — CID 135225897
5-[(2E,6E)-2,6-bis[(2E)-2-(1-pentan-2-ylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1-butyl-3-heptan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 135225897) has the molecular formula C57H68N4O3 and a molecular weight of 857.20 g/mol. Its IUPAC name is 5-[(2E,6E)-2,6-bis[(2E)-2-(1-pentan-2-ylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1-butyl-3-heptan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2E,6E)-2,6-bis[(2E)-2-(1-pentan-2-ylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1-butyl-3-heptan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 135225897 |
| Molecular Formula | C57H68N4O3 |
| Molecular Weight | 857.20 g/mol |
| Exact Mass | 856.53 |
| IUPAC Name | 5-[(2E,6E)-2,6-bis[(2E)-2-(1-pentan-2-ylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1-butyl-3-heptan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCC(C)N1C(=O)C(=C2/C(=C/C=c3\c4cccc5cccc(c54)n3C(C)CCC)CCC/C2=C\C=c2/c3cccc4cccc(c43)n2C(C)CCC)C(=O)N(CCCC)C1=O |
| InChI | InChI=1S/C57H68N4O3/c1-8-12-14-22-40(7)61-56(63)54(55(62)58(57(61)64)37-13-9-2)51-43(33-35-47-45-29-16-25-41-27-18-31-49(52(41)45)59(47)38(5)20-10-3)23-15-24-44(51)34-36-48-46-30-17-26-42-28-19-32-50(53(42)46)60(48)39(6)21-11-4/h16-19,25-36,38-40H,8-15,20-24,37H2,1-7H3/b43-33+,44-34+,47-35+,48-36+,54-51? |
| InChIKey | SWKXXCJPTSPEBD-DTABDDKDSA-N |
| XLogP | 13.22 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.20 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|