C48H50N4O3 — CID 153280722
5-[(2E,6E)-2,6-bis[(2E)-2-(1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 153280722) has the molecular formula C48H50N4O3 and a molecular weight of 730.95 g/mol. Its IUPAC name is 5-[(2E,6E)-2,6-bis[(2E)-2-(1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2E,6E)-2,6-bis[(2E)-2-(1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 153280722 |
| Molecular Formula | C48H50N4O3 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | 5-[(2E,6E)-2,6-bis[(2E)-2-(1-butylbenzo[cd]indol-2-ylidene)ethylidene]cyclohexylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCn1/c(=C/C=C2\CCC/C(=C\C=c3/c4cccc5cccc(c54)n3CCCC)C2=C2C(=O)N(CC)C(=O)N(CC)C2=O)c2cccc3cccc1c32 |
| InChI | InChI=1S/C48H50N4O3/c1-5-9-30-51-38(36-22-12-18-32-20-14-24-40(51)43(32)36)28-26-34-16-11-17-35(42(34)45-46(53)49(7-3)48(55)50(8-4)47(45)54)27-29-39-37-23-13-19-33-21-15-25-41(44(33)37)52(39)31-10-6-2/h12-15,18-29H,5-11,16-17,30-31H2,1-4H3/b34-26+,35-27+,38-28+,39-29+ |
| InChIKey | VOHDFQMVQNUUQE-RVAFNEMGSA-N |
| XLogP | 9.37 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|