C51H55N2O+ — CID 137150239
(2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[(E)-2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]-4-methylcyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole (PubChem CID 137150239) has the molecular formula C51H55N2O+ and a molecular weight of 712.01 g/mol. Its IUPAC name is (2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[(E)-2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]-4-methylcyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole.
| Compound Name | (2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[(E)-2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]-4-methylcyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole |
|---|---|
| PubChem CID | 137150239 |
| Molecular Formula | C51H55N2O+ |
| Molecular Weight | 712.01 g/mol |
| Exact Mass | 711.43 |
| IUPAC Name | (2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[(E)-2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]-4-methylcyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole |
| SMILES | CCCCOc1ccc(C2=C(/C=C/C3=[N+](CCCC)c4cccc5cccc3c45)C(C)CC/C2=C\C=c2/c3cccc4cccc(c43)n2CCCC)cc1 |
| InChI | InChI=1S/C51H55N2O/c1-5-8-33-52-45(43-19-11-15-37-17-13-21-47(52)50(37)43)31-27-39-24-23-36(4)42(49(39)40-25-28-41(29-26-40)54-35-10-7-3)30-32-46-44-20-12-16-38-18-14-22-48(51(38)44)53(46)34-9-6-2/h11-22,25-32,36H,5-10,23-24,33-35H2,1-4H3/q+1 |
| InChIKey | HSBOHEOPTWPNTJ-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.01 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|