C54H61N2S+ — CID 177419975
(2E)-2-[(2Z)-2-[2-(4-methylphenyl)sulfanyl-3-[(E)-2-(1-octylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1-octylbenzo[cd]indole (PubChem CID 177419975) has the molecular formula C54H61N2S+ and a molecular weight of 770.16 g/mol. Its IUPAC name is (2E)-2-[(2Z)-2-[2-(4-methylphenyl)sulfanyl-3-[(E)-2-(1-octylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1-octylbenzo[cd]indole.
| Compound Name | (2E)-2-[(2Z)-2-[2-(4-methylphenyl)sulfanyl-3-[(E)-2-(1-octylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1-octylbenzo[cd]indole |
|---|---|
| PubChem CID | 177419975 |
| Molecular Formula | C54H61N2S+ |
| Molecular Weight | 770.16 g/mol |
| Exact Mass | 769.45 |
| IUPAC Name | (2E)-2-[(2Z)-2-[2-(4-methylphenyl)sulfanyl-3-[(E)-2-(1-octylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclopent-2-en-1-ylidene]ethylidene]-1-octylbenzo[cd]indole |
| SMILES | CCCCCCCCn1/c(=C/C=C2/CCC(/C=C/C3=[N+](CCCCCCCC)c4cccc5cccc3c45)=C2Sc2ccc(C)cc2)c2cccc3cccc1c32 |
| InChI | InChI=1S/C54H61N2S/c1-4-6-8-10-12-14-38-55-48(46-24-16-20-41-22-18-26-50(55)52(41)46)36-32-43-30-31-44(54(43)57-45-34-28-40(3)29-35-45)33-37-49-47-25-17-21-42-23-19-27-51(53(42)47)56(49)39-15-13-11-9-7-5-2/h16-29,32-37H,4-15,30-31,38-39H2,1-3H3/q+1 |
| InChIKey | GUHKOLCIRMDNFR-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.16 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|