C50H53N2O+ — CID 171129626
(2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole (PubChem CID 171129626) has the molecular formula C50H53N2O+ and a molecular weight of 697.99 g/mol. Its IUPAC name is (2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole.
| Compound Name | (2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole |
|---|---|
| PubChem CID | 171129626 |
| Molecular Formula | C50H53N2O+ |
| Molecular Weight | 697.99 g/mol |
| Exact Mass | 697.42 |
| IUPAC Name | (2E)-2-[(2E)-2-[2-(4-butoxyphenyl)-3-[2-(1-butylbenzo[cd]indol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1-butylbenzo[cd]indole |
| SMILES | CCCCOc1ccc(C2=C(C=CC3=[N+](CCCC)c4cccc5cccc3c45)CCC/C2=C\C=c2/c3cccc4cccc(c43)n2CCCC)cc1 |
| InChI | InChI=1S/C50H53N2O/c1-4-7-33-51-44(42-21-11-17-36-19-13-23-46(51)49(36)42)31-27-38-15-10-16-39(48(38)40-25-29-41(30-26-40)53-35-9-6-3)28-32-45-43-22-12-18-37-20-14-24-47(50(37)43)52(45)34-8-5-2/h11-14,17-32H,4-10,15-16,33-35H2,1-3H3/q+1 |
| InChIKey | JHQNTFPBVUXWRJ-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.99 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|