C10H18N2 — CID 135226725
7-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-1-amine (PubChem CID 135226725) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 7-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-1-amine.
| Compound Name | 7-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-1-amine |
|---|---|
| PubChem CID | 135226725 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 7-methyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-1-amine |
| SMILES | CC1=CCC2CCCN(N)C2C1 |
| InChI | InChI=1S/C10H18N2/c1-8-4-5-9-3-2-6-12(11)10(9)7-8/h4,9-10H,2-3,5-7,11H2,1H3 |
| InChIKey | SIAHZMVRPKLNPH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|