About 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide
2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide (PubChem CID 135227701) has the molecular formula C19H16ClFN4
and a molecular weight of 354.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide |
| PubChem CID | 135227701 |
| Molecular Formula | C19H16ClFN4 |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide |
| SMILES | NNN/C(=N\c1ccccc1F)c1ccccc1-c1ccccc1Cl |
| InChI | InChI=1S/C19H16ClFN4/c20-16-10-4-3-8-14(16)13-7-1-2-9-15(13)19(24-25-22)23-18-12-6-5-11-17(18)21/h1-12,25H,22H2,(H,23,24) |
| InChIKey | ZPJYGIDDUKWMPA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide?
The IUPAC name of 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide (CID 135227701) is 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide.
What is the SMILES notation for 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide?
The canonical SMILES for 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide is NNN/C(=N\c1ccccc1F)c1ccccc1-c1ccccc1Cl.
What is the InChIKey of 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide?
The InChIKey is ZPJYGIDDUKWMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClFN4/c20-16-10-4-3-8-14(16)13-7-1-2-9-15(13)19(24-25-22)23-18-12-6-5-11-17(18)21/h1-12,25H,22H2,(H,23,24).
What are the key properties of 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide?
2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide has a molecular weight of 354.82 g/mol, XLogP of 4.19, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-N'-(2-fluorophenyl)-N-hydrazinylbenzenecarboximidamide is sourced from PubChem (CID 135227701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).