C17H19F2NS — CID 135227948
N-tert-butylsulfanyl-1,1-bis(4-fluorophenyl)methanamine (PubChem CID 135227948) has the molecular formula C17H19F2NS and a molecular weight of 307.41 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1,1-bis(4-fluorophenyl)methanamine.
| Compound Name | N-tert-butylsulfanyl-1,1-bis(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 135227948 |
| Molecular Formula | C17H19F2NS |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-tert-butylsulfanyl-1,1-bis(4-fluorophenyl)methanamine |
| SMILES | CC(C)(C)SNC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19F2NS/c1-17(2,3)21-20-16(12-4-8-14(18)9-5-12)13-6-10-15(19)11-7-13/h4-11,16,20H,1-3H3 |
| InChIKey | FQXZLWQCEBVVQR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|