About (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone
(5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone (PubChem CID 135228464) has the molecular formula C19H20FNO2
and a molecular weight of 313.37 g/mol. Its IUPAC name is (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone.
Molecular Properties
| Compound Name | (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone |
| PubChem CID | 135228464 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone |
| SMILES | Cc1cc(C(C)C)cc(C(=O)N2Cc3ccc(F)cc3C2)c1O |
| InChI | InChI=1S/C19H20FNO2/c1-11(2)14-6-12(3)18(22)17(8-14)19(23)21-9-13-4-5-16(20)7-15(13)10-21/h4-8,11,22H,9-10H2,1-3H3 |
| InChIKey | ZKXLZXRAVUHQSJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone?
The IUPAC name of (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone (CID 135228464) is (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone.
What is the SMILES notation for (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone?
The canonical SMILES for (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone is Cc1cc(C(C)C)cc(C(=O)N2Cc3ccc(F)cc3C2)c1O.
What is the InChIKey of (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone?
The InChIKey is ZKXLZXRAVUHQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FNO2/c1-11(2)14-6-12(3)18(22)17(8-14)19(23)21-9-13-4-5-16(20)7-15(13)10-21/h4-8,11,22H,9-10H2,1-3H3.
What are the key properties of (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone?
(5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone has a molecular weight of 313.37 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-1,3-dihydroisoindol-2-yl)-(2-hydroxy-3-methyl-5-propan-2-ylphenyl)methanone is sourced from PubChem (CID 135228464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).