C27H37N6O5+ — CID 135230059
4-[1-[[1-carboxy-2-[4-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)phenyl]ethyl]carbamoyl]cyclopentyl]butylimino-methyliminoazanium (PubChem CID 135230059) has the molecular formula C27H37N6O5+ and a molecular weight of 525.63 g/mol. Its IUPAC name is 4-[1-[[1-carboxy-2-[4-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)phenyl]ethyl]carbamoyl]cyclopentyl]butylimino-methyliminoazanium.
| Compound Name | 4-[1-[[1-carboxy-2-[4-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)phenyl]ethyl]carbamoyl]cyclopentyl]butylimino-methyliminoazanium |
|---|---|
| PubChem CID | 135230059 |
| Molecular Formula | C27H37N6O5+ |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 4-[1-[[1-carboxy-2-[4-(1,3,4-trimethyl-2,6-dioxopyrimidin-5-yl)phenyl]ethyl]carbamoyl]cyclopentyl]butylimino-methyliminoazanium |
| SMILES | CN=[N+]=NCCCCC1(C(=O)NC(Cc2ccc(-c3c(C)n(C)c(=O)n(C)c3=O)cc2)C(=O)O)CCCC1 |
| InChI | InChI=1S/C27H36N6O5/c1-18-22(23(34)33(4)26(38)32(18)3)20-11-9-19(10-12-20)17-21(24(35)36)30-25(37)27(13-5-6-14-27)15-7-8-16-29-31-28-2/h9-12,21H,5-8,13-17H2,1-4H3,(H-,30,35,36,37)/p+1 |
| InChIKey | JVZRGOLCXHDOOG-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 149.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|