C24H45N3 — CID 135231892
N-[3-(cyclohexylamino)propyl]-N'-[(5E)-5-methylocta-1,5,7-trien-2-yl]hexane-1,6-diamine (PubChem CID 135231892) has the molecular formula C24H45N3 and a molecular weight of 375.65 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)propyl]-N'-[(5E)-5-methylocta-1,5,7-trien-2-yl]hexane-1,6-diamine.
| Compound Name | N-[3-(cyclohexylamino)propyl]-N'-[(5E)-5-methylocta-1,5,7-trien-2-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 135231892 |
| Molecular Formula | C24H45N3 |
| Molecular Weight | 375.65 g/mol |
| Exact Mass | 375.36 |
| IUPAC Name | N-[3-(cyclohexylamino)propyl]-N'-[(5E)-5-methylocta-1,5,7-trien-2-yl]hexane-1,6-diamine |
| SMILES | C=C/C=C(\C)CCC(=C)NCCCCCCNCCCNC1CCCCC1 |
| InChI | InChI=1S/C24H45N3/c1-4-13-22(2)16-17-23(3)26-20-11-6-5-10-18-25-19-12-21-27-24-14-8-7-9-15-24/h4,13,24-27H,1,3,5-12,14-21H2,2H3/b22-13+ |
| InChIKey | XUTGTHUSVNMOMY-LPYMAVHISA-N |
| XLogP | 5.46 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|