C21H33FN2 — CID 176538907
4-[2-[(3Z,6Z)-2-fluoroocta-3,6-dienyl]-1H-pyridin-4-yl]-N-methyl-N-propylbutan-1-amine (PubChem CID 176538907) has the molecular formula C21H33FN2 and a molecular weight of 332.51 g/mol. Its IUPAC name is 4-[2-[(3Z,6Z)-2-fluoroocta-3,6-dienyl]-1H-pyridin-4-yl]-N-methyl-N-propylbutan-1-amine.
| Compound Name | 4-[2-[(3Z,6Z)-2-fluoroocta-3,6-dienyl]-1H-pyridin-4-yl]-N-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 176538907 |
| Molecular Formula | C21H33FN2 |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 4-[2-[(3Z,6Z)-2-fluoroocta-3,6-dienyl]-1H-pyridin-4-yl]-N-methyl-N-propylbutan-1-amine |
| SMILES | C/C=C\C/C=C\C(F)CC1=CC(CCCCN(C)CCC)=C=CN1 |
| InChI | InChI=1S/C21H33FN2/c1-4-6-7-8-12-20(22)18-21-17-19(13-14-23-21)11-9-10-16-24(3)15-5-2/h4,6,8,12,14,17,20,23H,5,7,9-11,15-16,18H2,1-3H3/b6-4-,12-8- |
| InChIKey | PXWHYKANSGDJKM-HHZHQPEGSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|