C18H27F2N3 — CID 135268704
(1Z)-1-N'-ethenyl-2-[[4-fluoro-5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N',3-N-trimethylbuta-1,3-diene-1,1,3-triamine (PubChem CID 135268704) has the molecular formula C18H27F2N3 and a molecular weight of 323.43 g/mol. Its IUPAC name is (1Z)-1-N'-ethenyl-2-[[4-fluoro-5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N',3-N-trimethylbuta-1,3-diene-1,1,3-triamine.
| Compound Name | (1Z)-1-N'-ethenyl-2-[[4-fluoro-5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N',3-N-trimethylbuta-1,3-diene-1,1,3-triamine |
|---|---|
| PubChem CID | 135268704 |
| Molecular Formula | C18H27F2N3 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (1Z)-1-N'-ethenyl-2-[[4-fluoro-5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N',3-N-trimethylbuta-1,3-diene-1,1,3-triamine |
| SMILES | C=CN(C)/C(NC)=C(/CC1=CCC(F)C(C(C)F)=C1)C(=C)NC |
| InChI | InChI=1S/C18H27F2N3/c1-7-23(6)18(22-5)16(13(3)21-4)11-14-8-9-17(20)15(10-14)12(2)19/h7-8,10,12,17,21-22H,1,3,9,11H2,2,4-6H3/b18-16- |
| InChIKey | FTPYVLDUZNQNPY-VLGSPTGOSA-N |
| XLogP | 3.57 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|