C17H25NO3 — CID 135232503
6-(5-hydroxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)hexanoic acid (PubChem CID 135232503) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 6-(5-hydroxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)hexanoic acid.
| Compound Name | 6-(5-hydroxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 135232503 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 6-(5-hydroxy-4,4-dimethyl-2,3-dihydroquinolin-1-yl)hexanoic acid |
| SMILES | CC1(C)CCN(CCCCCC(=O)O)c2cccc(O)c21 |
| InChI | InChI=1S/C17H25NO3/c1-17(2)10-12-18(11-5-3-4-9-15(20)21)13-7-6-8-14(19)16(13)17/h6-8,19H,3-5,9-12H2,1-2H3,(H,20,21) |
| InChIKey | DTENYOAIJHWVIA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|