C12H23N3O2 — CID 135232876
dimethylamino (3aR,6aS)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 135232876) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is dimethylamino (3aR,6aS)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | dimethylamino (3aR,6aS)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 135232876 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | dimethylamino (3aR,6aS)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)N1C[C@H]2CN(C(=O)ON(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C12H23N3O2/c1-9(2)14-5-10-7-15(8-11(10)6-14)12(16)17-13(3)4/h9-11H,5-8H2,1-4H3/t10-,11+ |
| InChIKey | PBSQOXMEFUFYDG-PHIMTYICSA-N |
| XLogP | 0.87 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|