C26H30N8OS — CID 135233179
[3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate (PubChem CID 135233179) has the molecular formula C26H30N8OS and a molecular weight of 502.65 g/mol. Its IUPAC name is [3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate.
| Compound Name | [3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate |
|---|---|
| PubChem CID | 135233179 |
| Molecular Formula | C26H30N8OS |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate |
| SMILES | [H]/N=C(/Sc1ccc2ncc(N3CCCN(CCO)CC3)cc2c1)n1cc(-c2cnn(C)c2)cc/c1=N\[H] |
| InChI | InChI=1S/C26H30N8OS/c1-31-17-21(15-30-31)19-3-6-25(27)34(18-19)26(28)36-23-4-5-24-20(14-23)13-22(16-29-24)33-8-2-7-32(9-10-33)11-12-35/h3-6,13-18,27-28,35H,2,7-12H2,1H3/b27-25+,28-26+ |
| InChIKey | IXGUVYXLTUXOKN-NBHCHVEOSA-N |
| XLogP | 3.00 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|