C25H27N7OS — CID 135233203
[3-(4-methoxypiperidin-1-yl)quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate (PubChem CID 135233203) has the molecular formula C25H27N7OS and a molecular weight of 473.61 g/mol. Its IUPAC name is [3-(4-methoxypiperidin-1-yl)quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate.
| Compound Name | [3-(4-methoxypiperidin-1-yl)quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate |
|---|---|
| PubChem CID | 135233203 |
| Molecular Formula | C25H27N7OS |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [3-(4-methoxypiperidin-1-yl)quinolin-6-yl] 2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate |
| SMILES | [H]/N=C(/Sc1ccc2ncc(N3CCC(OC)CC3)cc2c1)n1cc(-c2cnn(C)c2)cc/c1=N\[H] |
| InChI | InChI=1S/C25H27N7OS/c1-30-15-19(13-29-30)17-3-6-24(26)32(16-17)25(27)34-22-4-5-23-18(12-22)11-20(14-28-23)31-9-7-21(33-2)8-10-31/h3-6,11-16,21,26-27H,7-10H2,1-2H3/b26-24+,27-25+ |
| InChIKey | HZQPDTJPWPPLBM-OWUYFMIJSA-N |
| XLogP | 4.11 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|