C22H22FN7O2S — CID 144742770
[3-(2-hydroxyethylamino)-4-methoxyquinolin-6-yl] 3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate (PubChem CID 144742770) has the molecular formula C22H22FN7O2S and a molecular weight of 467.53 g/mol. Its IUPAC name is [3-(2-hydroxyethylamino)-4-methoxyquinolin-6-yl] 3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate.
| Compound Name | [3-(2-hydroxyethylamino)-4-methoxyquinolin-6-yl] 3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate |
|---|---|
| PubChem CID | 144742770 |
| Molecular Formula | C22H22FN7O2S |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [3-(2-hydroxyethylamino)-4-methoxyquinolin-6-yl] 3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)pyridine-1-carboximidothioate |
| SMILES | [H]/N=C(/Sc1ccc2ncc(NCCO)c(OC)c2c1)n1cc(-c2cnn(C)c2)cc(F)/c1=N\[H] |
| InChI | InChI=1S/C22H22FN7O2S/c1-29-11-14(9-28-29)13-7-17(23)21(24)30(12-13)22(25)33-15-3-4-18-16(8-15)20(32-2)19(10-27-18)26-5-6-31/h3-4,7-12,24-26,31H,5-6H2,1-2H3/b24-21+,25-22+ |
| InChIKey | QYRBPXXLYIXWBA-VNABVMDTSA-N |
| XLogP | 3.04 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|