C24H28FN7O3 — CID 130284852
N-[1-[3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)-1-pyridinyl]-1-iminopropan-2-yl]-N-[(Z)-2-[5-(2-methoxyethoxy)-3-methyl-2-pyridinyl]ethenyl]formamide (PubChem CID 130284852) has the molecular formula C24H28FN7O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is N-[1-[3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)-1-pyridinyl]-1-iminopropan-2-yl]-N-[(Z)-2-[5-(2-methoxyethoxy)-3-methyl-2-pyridinyl]ethenyl]formamide.
| Compound Name | N-[1-[3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)-1-pyridinyl]-1-iminopropan-2-yl]-N-[(Z)-2-[5-(2-methoxyethoxy)-3-methyl-2-pyridinyl]ethenyl]formamide |
|---|---|
| PubChem CID | 130284852 |
| Molecular Formula | C24H28FN7O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[1-[3-fluoro-2-imino-5-(1-methylpyrazol-4-yl)-1-pyridinyl]-1-iminopropan-2-yl]-N-[(Z)-2-[5-(2-methoxyethoxy)-3-methyl-2-pyridinyl]ethenyl]formamide |
| SMILES | [H]/N=C(/C(C)N(C=O)/C=C\c1ncc(OCCOC)cc1C)n1cc(-c2cnn(C)c2)cc(F)/c1=N\[H] |
| InChI | InChI=1S/C24H28FN7O3/c1-16-9-20(35-8-7-34-4)12-28-22(16)5-6-31(15-33)17(2)23(26)32-14-18(10-21(25)24(32)27)19-11-29-30(3)13-19/h5-6,9-15,17,26-27H,7-8H2,1-4H3/b6-5-,26-23-,27-24+ |
| InChIKey | UFHPGIVWZPZGGQ-PKIBLBHZSA-N |
| XLogP | 2.58 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|