C27H21F3N6O — CID 130284051
1-[2,2-difluoro-2-(3-phenylmethoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-2-imine (PubChem CID 130284051) has the molecular formula C27H21F3N6O and a molecular weight of 502.50 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-(3-phenylmethoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-2-imine.
| Compound Name | 1-[2,2-difluoro-2-(3-phenylmethoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-2-imine |
|---|---|
| PubChem CID | 130284051 |
| Molecular Formula | C27H21F3N6O |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 1-[2,2-difluoro-2-(3-phenylmethoxyquinolin-6-yl)ethanimidoyl]-3-fluoro-5-(1-methylpyrazol-4-yl)pyridin-2-imine |
| SMILES | [H]/N=C(\n1cc(-c2cnn(C)c2)cc(F)/c1=N\[H])C(F)(F)c1ccc2ncc(OCc3ccccc3)cc2c1 |
| InChI | InChI=1S/C27H21F3N6O/c1-35-14-20(12-34-35)19-11-23(28)25(31)36(15-19)26(32)27(29,30)21-7-8-24-18(9-21)10-22(13-33-24)37-16-17-5-3-2-4-6-17/h2-15,31-32H,16H2,1H3/b31-25+,32-26- |
| InChIKey | HPTAGJJDFZVWID-LLDCJDQVSA-N |
| XLogP | 5.25 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|