C16H21N3 — CID 135234673
(3E)-N-[2-(3a,7a-dihydro-1H-indol-3-yl)ethyl]-3-methyl-4-(methylideneamino)buta-1,3-dien-2-amine (PubChem CID 135234673) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (3E)-N-[2-(3a,7a-dihydro-1H-indol-3-yl)ethyl]-3-methyl-4-(methylideneamino)buta-1,3-dien-2-amine.
| Compound Name | (3E)-N-[2-(3a,7a-dihydro-1H-indol-3-yl)ethyl]-3-methyl-4-(methylideneamino)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 135234673 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (3E)-N-[2-(3a,7a-dihydro-1H-indol-3-yl)ethyl]-3-methyl-4-(methylideneamino)buta-1,3-dien-2-amine |
| SMILES | C=N/C=C(\C)C(=C)NCCC1=CNC2C=CC=CC12 |
| InChI | InChI=1S/C16H21N3/c1-12(10-17-3)13(2)18-9-8-14-11-19-16-7-5-4-6-15(14)16/h4-7,10-11,15-16,18-19H,2-3,8-9H2,1H3/b12-10+ |
| InChIKey | BUDQSCJUZAIWIM-ZRDIBKRKSA-N |
| XLogP | 2.68 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|