C19H20F6N4O3 — CID 135238474
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-cyano-3-pyridinyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 135238474) has the molecular formula C19H20F6N4O3 and a molecular weight of 466.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-cyano-3-pyridinyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-cyano-3-pyridinyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135238474 |
| Molecular Formula | C19H20F6N4O3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(2-cyano-3-pyridinyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | N#Cc1ncccc1CN1CCOC2(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C19H20F6N4O3/c20-18(21,22)15(19(23,24)25)32-16(30)29-6-3-17(4-7-29)12-28(8-9-31-17)11-13-2-1-5-27-14(13)10-26/h1-2,5,15H,3-4,6-9,11-12H2 |
| InChIKey | LYEFIYQBQCLJIL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |