C18H29NO5 — CID 135239405
1-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridin-3-yl]octan-1-one (PubChem CID 135239405) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 1-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridin-3-yl]octan-1-one.
| Compound Name | 1-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridin-3-yl]octan-1-one |
|---|---|
| PubChem CID | 135239405 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 1-[1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridin-3-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)C1=CN([C@@H]2O[C@H](CO)[C@H](O)[C@@H]2O)C=CC1 |
| InChI | InChI=1S/C18H29NO5/c1-2-3-4-5-6-9-14(21)13-8-7-10-19(11-13)18-17(23)16(22)15(12-20)24-18/h7,10-11,15-18,20,22-23H,2-6,8-9,12H2,1H3/t15-,16+,17+,18-/m1/s1 |
| InChIKey | PCQJCNIWRHSWMV-VSZNYVQBSA-N |
| XLogP | 1.46 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|