C15H23NO6 — CID 135255357
butyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate (PubChem CID 135255357) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is butyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate.
| Compound Name | butyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 135255357 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | butyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)C1=CN(C2OC(CO)C(O)C2O)C=CC1 |
| InChI | InChI=1S/C15H23NO6/c1-2-3-7-21-15(20)10-5-4-6-16(8-10)14-13(19)12(18)11(9-17)22-14/h4,6,8,11-14,17-19H,2-3,5,7,9H2,1H3 |
| InChIKey | CWIIEICYCIJHDD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|