3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid

C6H6F3NO3 — CID 135239438

IUPAC3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid
SMILESCc1ccon1.O=C(O)C(F)(F)F
InChIInChI=1S/C4H5NO.C2HF3O2/c1-4-2-3-6-5-4;3-2(4,5)1(6)7/h2-3H,1H3;(H,6,7)
InChIKeyFVCZHNVMMCTKEV-UHFFFAOYSA-N
MW197.11 g/mol
LogP1.62
Rot. Bonds

About 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid

3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid (PubChem CID 135239438) has the molecular formula C6H6F3NO3 and a molecular weight of 197.11 g/mol. Its IUPAC name is 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid
PubChem CID135239438
Molecular FormulaC6H6F3NO3
Molecular Weight197.11 g/mol
Exact Mass197.03
IUPAC Name3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid
SMILESCc1ccon1.O=C(O)C(F)(F)F
InChIInChI=1S/C4H5NO.C2HF3O2/c1-4-2-3-6-5-4;3-2(4,5)1(6)7/h2-3H,1H3;(H,6,7)
InChIKeyFVCZHNVMMCTKEV-UHFFFAOYSA-N
XLogP1.62
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.11
LogP ≤ 51.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid (CID 135239438) is 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid is Cc1ccon1.O=C(O)C(F)(F)F.
What is the InChIKey of 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid?
The InChIKey is FVCZHNVMMCTKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO.C2HF3O2/c1-4-2-3-6-5-4;3-2(4,5)1(6)7/h2-3H,1H3;(H,6,7).
What are the key properties of 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid?
3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid has a molecular weight of 197.11 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2-oxazole;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 135239438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).