C6H4FNO3 — CID 170439198
(Z)-2-fluoro-3-(1,2-oxazol-3-yl)prop-2-enoic acid (PubChem CID 170439198) has the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. Its IUPAC name is (Z)-2-fluoro-3-(1,2-oxazol-3-yl)prop-2-enoic acid.
| Compound Name | (Z)-2-fluoro-3-(1,2-oxazol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 170439198 |
| Molecular Formula | C6H4FNO3 |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | (Z)-2-fluoro-3-(1,2-oxazol-3-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(F)=C/c1ccon1 |
| InChI | InChI=1S/C6H4FNO3/c7-5(6(9)10)3-4-1-2-11-8-4/h1-3H,(H,9,10)/b5-3- |
| InChIKey | XENVVAPFIYIYCR-HYXAFXHYSA-N |
| XLogP | 1.07 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|