C9H11NO — CID 142206961
3-[(1E)-4-methylpenta-1,3-dienyl]-1,2-oxazole (PubChem CID 142206961) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-[(1E)-4-methylpenta-1,3-dienyl]-1,2-oxazole.
| Compound Name | 3-[(1E)-4-methylpenta-1,3-dienyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142206961 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-[(1E)-4-methylpenta-1,3-dienyl]-1,2-oxazole |
| SMILES | CC(C)=C/C=C/c1ccon1 |
| InChI | InChI=1S/C9H11NO/c1-8(2)4-3-5-9-6-7-11-10-9/h3-7H,1-2H3/b5-3+ |
| InChIKey | FHZNGXLZPHCACZ-HWKANZROSA-N |
| XLogP | 2.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|