C7H9F2N3O2 — CID 135240999
6,6-difluoro-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 135240999) has the molecular formula C7H9F2N3O2 and a molecular weight of 205.16 g/mol. Its IUPAC name is 6,6-difluoro-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 6,6-difluoro-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 135240999 |
| Molecular Formula | C7H9F2N3O2 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 6,6-difluoro-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCNCC2(F)F)N1 |
| InChI | InChI=1S/C7H9F2N3O2/c8-7(9)3-10-2-1-6(7)4(13)11-5(14)12-6/h10H,1-3H2,(H2,11,12,13,14) |
| InChIKey | IZGHPZIFIAWQPG-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|