C11H15F4NO3 — CID 135241339
tert-butyl (3S)-3-fluoro-4-oxo-3-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 135241339) has the molecular formula C11H15F4NO3 and a molecular weight of 285.24 g/mol. Its IUPAC name is tert-butyl (3S)-3-fluoro-4-oxo-3-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-fluoro-4-oxo-3-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135241339 |
| Molecular Formula | C11H15F4NO3 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl (3S)-3-fluoro-4-oxo-3-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)[C@](F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F4NO3/c1-9(2,3)19-8(18)16-5-4-7(17)10(12,6-16)11(13,14)15/h4-6H2,1-3H3/t10-/m0/s1 |
| InChIKey | BZWJHESUXZRMCQ-JTQLQIEISA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |