C24H39NO2 — CID 135244431
(Z,5E)-2-[(1S)-3,6-dimethylcyclohex-2-en-1-yl]-5-[1-(2-methylpropylamino)ethylidene]-4-oxodec-2-enal (PubChem CID 135244431) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (Z,5E)-2-[(1S)-3,6-dimethylcyclohex-2-en-1-yl]-5-[1-(2-methylpropylamino)ethylidene]-4-oxodec-2-enal.
| Compound Name | (Z,5E)-2-[(1S)-3,6-dimethylcyclohex-2-en-1-yl]-5-[1-(2-methylpropylamino)ethylidene]-4-oxodec-2-enal |
|---|---|
| PubChem CID | 135244431 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (Z,5E)-2-[(1S)-3,6-dimethylcyclohex-2-en-1-yl]-5-[1-(2-methylpropylamino)ethylidene]-4-oxodec-2-enal |
| SMILES | CCCCC/C(C(=O)/C=C(\C=O)[C@@H]1C=C(C)CCC1C)=C(/C)NCC(C)C |
| InChI | InChI=1S/C24H39NO2/c1-7-8-9-10-22(20(6)25-15-17(2)3)24(27)14-21(16-26)23-13-18(4)11-12-19(23)5/h13-14,16-17,19,23,25H,7-12,15H2,1-6H3/b21-14+,22-20+/t19?,23-/m1/s1 |
| InChIKey | QFMOXIQXMQGSRY-JOGPYQLBSA-N |
| XLogP | 5.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|