C22H30Cl2O — CID 155322270
(Z,4E)-3-chloro-4-(1-chloroprop-2-ynylidene)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]non-2-en-2-ol (PubChem CID 155322270) has the molecular formula C22H30Cl2O and a molecular weight of 381.39 g/mol. Its IUPAC name is (Z,4E)-3-chloro-4-(1-chloroprop-2-ynylidene)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]non-2-en-2-ol.
| Compound Name | (Z,4E)-3-chloro-4-(1-chloroprop-2-ynylidene)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]non-2-en-2-ol |
|---|---|
| PubChem CID | 155322270 |
| Molecular Formula | C22H30Cl2O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (Z,4E)-3-chloro-4-(1-chloroprop-2-ynylidene)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]non-2-en-2-ol |
| SMILES | C#C/C(Cl)=C(CCCCC)\C(Cl)=C(\O)C[C@@H]1C=C(C)CC[C@H]1C(=C)C |
| InChI | InChI=1S/C22H30Cl2O/c1-6-8-9-10-19(20(23)7-2)22(24)21(25)14-17-13-16(5)11-12-18(17)15(3)4/h2,13,17-18,25H,3,6,8-12,14H2,1,4-5H3/b20-19+,22-21-/t17-,18-/m0/s1 |
| InChIKey | PCMGWQWZTLWQBC-PSCRGUGHSA-N |
| XLogP | 7.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|