C12H18O — CID 146512478
2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)acetaldehyde (PubChem CID 146512478) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)acetaldehyde.
| Compound Name | 2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 146512478 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)acetaldehyde |
| SMILES | C=C(C)C1CCC(C)=CC1CC=O |
| InChI | InChI=1S/C12H18O/c1-9(2)12-5-4-10(3)8-11(12)6-7-13/h7-8,11-12H,1,4-6H2,2-3H3 |
| InChIKey | XEDHONGDKBHMRB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|