C16H26O2 — CID 146332786
(E)-4-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)pent-2-ene-2,4-diol (PubChem CID 146332786) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (E)-4-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)pent-2-ene-2,4-diol.
| Compound Name | (E)-4-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)pent-2-ene-2,4-diol |
|---|---|
| PubChem CID | 146332786 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (E)-4-methyl-3-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)pent-2-ene-2,4-diol |
| SMILES | C=C(C)C1CCC(C)=CC1/C(=C(/C)O)C(C)(C)O |
| InChI | InChI=1S/C16H26O2/c1-10(2)13-8-7-11(3)9-14(13)15(12(4)17)16(5,6)18/h9,13-14,17-18H,1,7-8H2,2-6H3/b15-12+ |
| InChIKey | ODFBMGPRQHWINB-NTCAYCPXSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|