C24H36 — CID 158715373
1-tert-butyl-3-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene (PubChem CID 158715373) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene.
| Compound Name | 1-tert-butyl-3-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene |
|---|---|
| PubChem CID | 158715373 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-tert-butyl-3-methyl-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylbenzene |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(C)cc(CCC)cc1C(C)(C)C |
| InChI | InChI=1S/C24H36/c1-9-10-19-14-18(5)23(22(15-19)24(6,7)8)21-13-17(4)11-12-20(21)16(2)3/h13-15,20-21H,2,9-12H2,1,3-8H3/t20-,21+/m0/s1 |
| InChIKey | KVTATNLSJHCNPM-LEWJYISDSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|