C25H41NO — CID 135244424
(2E,5E)-6-ethenyl-3-(3-methylcyclohex-2-en-1-yl)-4-methylidene-5-(2-methylpropylamino)undeca-2,5-dien-2-ol (PubChem CID 135244424) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is (2E,5E)-6-ethenyl-3-(3-methylcyclohex-2-en-1-yl)-4-methylidene-5-(2-methylpropylamino)undeca-2,5-dien-2-ol.
| Compound Name | (2E,5E)-6-ethenyl-3-(3-methylcyclohex-2-en-1-yl)-4-methylidene-5-(2-methylpropylamino)undeca-2,5-dien-2-ol |
|---|---|
| PubChem CID | 135244424 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | (2E,5E)-6-ethenyl-3-(3-methylcyclohex-2-en-1-yl)-4-methylidene-5-(2-methylpropylamino)undeca-2,5-dien-2-ol |
| SMILES | C=C/C(CCCCC)=C(/NCC(C)C)C(=C)/C(=C(\C)O)C1C=C(C)CCC1 |
| InChI | InChI=1S/C25H41NO/c1-8-10-11-14-22(9-2)25(26-17-18(3)4)20(6)24(21(7)27)23-15-12-13-19(5)16-23/h9,16,18,23,26-27H,2,6,8,10-15,17H2,1,3-5,7H3/b24-21-,25-22- |
| InChIKey | RKRIDERFWKZNKL-NUJSLWOLSA-N |
| XLogP | 7.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|