C28H40O8 — CID 162377104
(3R)-1,3-dimethylcyclohexene;methyl 2,4-diacetyloxy-6-pentylbenzoate;prop-2-enoic acid (PubChem CID 162377104) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is (3R)-1,3-dimethylcyclohexene;methyl 2,4-diacetyloxy-6-pentylbenzoate;prop-2-enoic acid.
| Compound Name | (3R)-1,3-dimethylcyclohexene;methyl 2,4-diacetyloxy-6-pentylbenzoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 162377104 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (3R)-1,3-dimethylcyclohexene;methyl 2,4-diacetyloxy-6-pentylbenzoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC1=C[C@H](C)CCC1.CCCCCc1cc(OC(C)=O)cc(OC(C)=O)c1C(=O)OC |
| InChI | InChI=1S/C17H22O6.C8H14.C3H4O2/c1-5-6-7-8-13-9-14(22-11(2)18)10-15(23-12(3)19)16(13)17(20)21-4;1-7-4-3-5-8(2)6-7;1-2-3(4)5/h9-10H,5-8H2,1-4H3;6-7H,3-5H2,1-2H3;2H,1H2,(H,4,5)/t;7-;/m.1./s1 |
| InChIKey | QKCSBFAQCAECHX-QABCSGHHSA-N |
| XLogP | 6.07 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|