C9H10BrCl2N — CID 135244904
N-bromo-1-(2,4-dichloro-3-methylphenyl)-N-methylmethanamine (PubChem CID 135244904) has the molecular formula C9H10BrCl2N and a molecular weight of 283.00 g/mol. Its IUPAC name is N-bromo-1-(2,4-dichloro-3-methylphenyl)-N-methylmethanamine.
| Compound Name | N-bromo-1-(2,4-dichloro-3-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 135244904 |
| Molecular Formula | C9H10BrCl2N |
| Molecular Weight | 283.00 g/mol |
| Exact Mass | 280.94 |
| IUPAC Name | N-bromo-1-(2,4-dichloro-3-methylphenyl)-N-methylmethanamine |
| SMILES | Cc1c(Cl)ccc(CN(C)Br)c1Cl |
| InChI | InChI=1S/C9H10BrCl2N/c1-6-8(11)4-3-7(9(6)12)5-13(2)10/h3-4H,5H2,1-2H3 |
| InChIKey | GQGMFLCPOYKVTI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|