C11H24N2O2 — CID 135244918
(2R)-3-butoxy-N,N-diethyl-2-nitrosopropan-1-amine (PubChem CID 135244918) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R)-3-butoxy-N,N-diethyl-2-nitrosopropan-1-amine.
| Compound Name | (2R)-3-butoxy-N,N-diethyl-2-nitrosopropan-1-amine |
|---|---|
| PubChem CID | 135244918 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | (2R)-3-butoxy-N,N-diethyl-2-nitrosopropan-1-amine |
| SMILES | CCCCOC[C@@H](CN(CC)CC)N=O |
| InChI | InChI=1S/C11H24N2O2/c1-4-7-8-15-10-11(12-14)9-13(5-2)6-3/h11H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | XPNPVZCWRLWZHW-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|