C26H33Cl2N3O4S — CID 135244970
N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-4-oxobutanamide (PubChem CID 135244970) has the molecular formula C26H33Cl2N3O4S and a molecular weight of 554.54 g/mol. Its IUPAC name is N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-4-oxobutanamide.
| Compound Name | N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 135244970 |
| Molecular Formula | C26H33Cl2N3O4S |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-4-oxobutanamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2cccc(SNCCOCCOCCNC(=O)CCC=O)c2)C1 |
| InChI | InChI=1S/C26H33Cl2N3O4S/c1-31-17-23(22-15-20(27)16-25(28)24(22)18-31)19-4-2-5-21(14-19)36-30-8-11-35-13-12-34-10-7-29-26(33)6-3-9-32/h2,4-5,9,14-16,23,30H,3,6-8,10-13,17-18H2,1H3,(H,29,33) |
| InChIKey | HNKOOPIDUCLSAN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|