C32H47Cl2N3O4S — CID 139417175
N-[2-[2-[2-[[3-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-6-hydroxy-4-propylheptanamide (PubChem CID 139417175) has the molecular formula C32H47Cl2N3O4S and a molecular weight of 640.72 g/mol. Its IUPAC name is N-[2-[2-[2-[[3-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-6-hydroxy-4-propylheptanamide.
| Compound Name | N-[2-[2-[2-[[3-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-6-hydroxy-4-propylheptanamide |
|---|---|
| PubChem CID | 139417175 |
| Molecular Formula | C32H47Cl2N3O4S |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | N-[2-[2-[2-[[3-[(4S)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-6-hydroxy-4-propylheptanamide |
| SMILES | CCCC(CCC(=O)NCCOCCOCCNSc1cccc([C@@H]2CN(C)Cc3c(Cl)cc(Cl)cc32)c1)CC(C)O |
| InChI | InChI=1S/C32H47Cl2N3O4S/c1-4-6-24(17-23(2)38)9-10-32(39)35-11-13-40-15-16-41-14-12-36-42-27-8-5-7-25(18-27)29-21-37(3)22-30-28(29)19-26(33)20-31(30)34/h5,7-8,18-20,23-24,29,36,38H,4,6,9-17,21-22H2,1-3H3,(H,35,39)/t23?,24?,29-/m0/s1 |
| InChIKey | WQPGPXRPTIZBJJ-DHCVZJGKSA-N |
| XLogP | 6.28 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|