C27H35Cl2N3O4S — CID 135245028
N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-2,2-dimethyl-3-oxopropanamide (PubChem CID 135245028) has the molecular formula C27H35Cl2N3O4S and a molecular weight of 568.57 g/mol. Its IUPAC name is N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 135245028 |
| Molecular Formula | C27H35Cl2N3O4S |
| Molecular Weight | 568.57 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | N-[2-[2-[2-[[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfanylamino]ethoxy]ethoxy]ethyl]-2,2-dimethyl-3-oxopropanamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2cccc(SNCCOCCOCCNC(=O)C(C)(C)C=O)c2)C1 |
| InChI | InChI=1S/C27H35Cl2N3O4S/c1-27(2,18-33)26(34)30-7-9-35-11-12-36-10-8-31-37-21-6-4-5-19(13-21)23-16-32(3)17-24-22(23)14-20(28)15-25(24)29/h4-6,13-15,18,23,31H,7-12,16-17H2,1-3H3,(H,30,34) |
| InChIKey | NADCOSCQNWNWNV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|