C41H31F2N3 — CID 135247163
2-[7-(8a,9-dihydro-4bH-fluoren-3-yl)-9,9-difluorofluoren-2-yl]-4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 135247163) has the molecular formula C41H31F2N3 and a molecular weight of 603.72 g/mol. Its IUPAC name is 2-[7-(8a,9-dihydro-4bH-fluoren-3-yl)-9,9-difluorofluoren-2-yl]-4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[7-(8a,9-dihydro-4bH-fluoren-3-yl)-9,9-difluorofluoren-2-yl]-4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 135247163 |
| Molecular Formula | C41H31F2N3 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 2-[7-(8a,9-dihydro-4bH-fluoren-3-yl)-9,9-difluorofluoren-2-yl]-4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | FC1(F)c2cc(C3=NC(C4=CC=CCC4)N=C(c4ccccc4)N3)ccc2-c2ccc(-c3ccc4c(c3)C3C=CC=CC3C4)cc21 |
| InChI | InChI=1S/C41H31F2N3/c42-41(43)36-23-28(27-15-16-30-21-29-13-7-8-14-32(29)35(30)22-27)17-19-33(36)34-20-18-31(24-37(34)41)40-45-38(25-9-3-1-4-10-25)44-39(46-40)26-11-5-2-6-12-26/h1-5,7-11,13-20,22-24,29,32,39H,6,12,21H2,(H,44,45,46) |
| InChIKey | QVZCDVJWUYZSCC-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |