C67H52N2 — CID 135254896
3'-[(1Z)-buta-1,3-dienyl]-1-N,2-N'-bis(9,9-dimethylfluoren-2-yl)-1-N,2-N'-diphenylspiro[fluorene-9,1'-indene]-1,2'-diamine (PubChem CID 135254896) has the molecular formula C67H52N2 and a molecular weight of 885.17 g/mol. Its IUPAC name is 3'-[(1Z)-buta-1,3-dienyl]-1-N,2-N'-bis(9,9-dimethylfluoren-2-yl)-1-N,2-N'-diphenylspiro[fluorene-9,1'-indene]-1,2'-diamine.
| Compound Name | 3'-[(1Z)-buta-1,3-dienyl]-1-N,2-N'-bis(9,9-dimethylfluoren-2-yl)-1-N,2-N'-diphenylspiro[fluorene-9,1'-indene]-1,2'-diamine |
|---|---|
| PubChem CID | 135254896 |
| Molecular Formula | C67H52N2 |
| Molecular Weight | 885.17 g/mol |
| Exact Mass | 884.41 |
| IUPAC Name | 3'-[(1Z)-buta-1,3-dienyl]-1-N,2-N'-bis(9,9-dimethylfluoren-2-yl)-1-N,2-N'-diphenylspiro[fluorene-9,1'-indene]-1,2'-diamine |
| SMILES | C=C/C=C\C1=C(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)C2(c3ccccc31)c1ccccc1-c1cccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c12 |
| InChI | InChI=1S/C67H52N2/c1-6-7-27-55-51-31-17-21-36-59(51)67(64(55)69(45-25-12-9-13-26-45)47-39-41-53-49-29-15-19-34-57(49)66(4,5)61(53)43-47)58-35-20-16-30-50(58)54-32-22-37-62(63(54)67)68(44-23-10-8-11-24-44)46-38-40-52-48-28-14-18-33-56(48)65(2,3)60(52)42-46/h6-43H,1H2,2-5H3/b27-7- |
| InChIKey | HYNLLTDZGQBEKN-FEDGQQDLSA-N |
| XLogP | 17.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.17 |
| LogP ≤ 5 | 17.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|