C21H18Cl2N4O5 — CID 135255112
ethyl 2-[3-[(1S)-2-(4-chlorophenyl)-1-[(4-chlorophenyl)carbamoylamino]ethyl]-1,2,4-oxadiazol-5-yl]-2-oxoacetate (PubChem CID 135255112) has the molecular formula C21H18Cl2N4O5 and a molecular weight of 477.30 g/mol. Its IUPAC name is ethyl 2-[3-[(1S)-2-(4-chlorophenyl)-1-[(4-chlorophenyl)carbamoylamino]ethyl]-1,2,4-oxadiazol-5-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[3-[(1S)-2-(4-chlorophenyl)-1-[(4-chlorophenyl)carbamoylamino]ethyl]-1,2,4-oxadiazol-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 135255112 |
| Molecular Formula | C21H18Cl2N4O5 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | ethyl 2-[3-[(1S)-2-(4-chlorophenyl)-1-[(4-chlorophenyl)carbamoylamino]ethyl]-1,2,4-oxadiazol-5-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1nc([C@H](Cc2ccc(Cl)cc2)NC(=O)Nc2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C21H18Cl2N4O5/c1-2-31-20(29)17(28)19-26-18(27-32-19)16(11-12-3-5-13(22)6-4-12)25-21(30)24-15-9-7-14(23)8-10-15/h3-10,16H,2,11H2,1H3,(H2,24,25,30)/t16-/m0/s1 |
| InChIKey | VIWWOLPAOBCNLE-INIZCTEOSA-N |
| XLogP | 4.23 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|