C9H16N2 — CID 135257456
N'-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]ethanimidamide (PubChem CID 135257456) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]ethanimidamide.
| Compound Name | N'-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 135257456 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-[(2Z,4Z)-4-methylhexa-2,4-dien-2-yl]ethanimidamide |
| SMILES | C/C=C(C)\C=C(C)/N=C(\C)N |
| InChI | InChI=1S/C9H16N2/c1-5-7(2)6-8(3)11-9(4)10/h5-6H,1-4H3,(H2,10,11)/b7-5-,8-6- |
| InChIKey | GAJTYVDMNAVPFP-SFECMWDFSA-N |
| XLogP | 2.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|