C24H32N4O4 — CID 135257993
diethyl 2-[[[2-(1-benzylpiperidin-4-yl)-5-methylpyrazol-3-yl]amino]methylidene]propanedioate (PubChem CID 135257993) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is diethyl 2-[[[2-(1-benzylpiperidin-4-yl)-5-methylpyrazol-3-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[2-(1-benzylpiperidin-4-yl)-5-methylpyrazol-3-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 135257993 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | diethyl 2-[[[2-(1-benzylpiperidin-4-yl)-5-methylpyrazol-3-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cc(C)nn1C1CCN(Cc2ccccc2)CC1)C(=O)OCC |
| InChI | InChI=1S/C24H32N4O4/c1-4-31-23(29)21(24(30)32-5-2)16-25-22-15-18(3)26-28(22)20-11-13-27(14-12-20)17-19-9-7-6-8-10-19/h6-10,15-16,20,25H,4-5,11-14,17H2,1-3H3 |
| InChIKey | NLSXTIFQZZBVHV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|